C25H31ClN6O4S2 — CID 147888827
N-[(1R,2S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-4-(methanesulfonamidomethyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 147888827) has the molecular formula C25H31ClN6O4S2 and a molecular weight of 579.15 g/mol. Its IUPAC name is N-[(1R,2S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-4-(methanesulfonamidomethyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(1R,2S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-4-(methanesulfonamidomethyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 147888827 |
| Molecular Formula | C25H31ClN6O4S2 |
| Molecular Weight | 579.15 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | N-[(1R,2S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-4-(methanesulfonamidomethyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3CCC(CNS(C)(=O)=O)C[C@@H]3NC(=O)c3cc4cc(Cl)ccc4[nH]3)sc2C1 |
| InChI | InChI=1S/C25H31ClN6O4S2/c1-32-8-7-19-22(13-32)37-25(31-19)24(34)29-18-5-3-14(12-27-38(2,35)36)9-20(18)30-23(33)21-11-15-10-16(26)4-6-17(15)28-21/h4,6,10-11,14,18,20,27-28H,3,5,7-9,12-13H2,1-2H3,(H,29,34)(H,30,33)/t14?,18-,20+/m1/s1 |
| InChIKey | IBWFNYJEWQWJEC-UCPOHXDKSA-N |
| XLogP | 2.51 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |