C18H35NO2S — CID 163452909
2-ethyl-N-(2-hydroxyethyl)-2-[(Z)-8-methylnon-5-enyl]sulfanylbutanamide (PubChem CID 163452909) has the molecular formula C18H35NO2S and a molecular weight of 329.55 g/mol. Its IUPAC name is 2-ethyl-N-(2-hydroxyethyl)-2-[(Z)-8-methylnon-5-enyl]sulfanylbutanamide.
| Compound Name | 2-ethyl-N-(2-hydroxyethyl)-2-[(Z)-8-methylnon-5-enyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 163452909 |
| Molecular Formula | C18H35NO2S |
| Molecular Weight | 329.55 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 2-ethyl-N-(2-hydroxyethyl)-2-[(Z)-8-methylnon-5-enyl]sulfanylbutanamide |
| SMILES | CCC(CC)(SCCCC/C=C\CC(C)C)C(=O)NCCO |
| InChI | InChI=1S/C18H35NO2S/c1-5-18(6-2,17(21)19-13-14-20)22-15-11-9-7-8-10-12-16(3)4/h8,10,16,20H,5-7,9,11-15H2,1-4H3,(H,19,21)/b10-8- |
| InChIKey | BIAPJVCNFBJDSK-NTMALXAHSA-N |
| XLogP | 4.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|