C17H24ClFN4O3 — CID 163456540
tert-butyl N-[(1S)-2-[(5-carbamoyl-6-chloro-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate (PubChem CID 163456540) has the molecular formula C17H24ClFN4O3 and a molecular weight of 386.86 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(5-carbamoyl-6-chloro-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(5-carbamoyl-6-chloro-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 163456540 |
| Molecular Formula | C17H24ClFN4O3 |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(5-carbamoyl-6-chloro-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCC1Nc1nc(Cl)c(C(N)=O)cc1F |
| InChI | InChI=1S/C17H24ClFN4O3/c1-17(2,3)26-16(25)22-12-7-5-4-6-11(12)21-15-10(19)8-9(14(20)24)13(18)23-15/h8,11-12H,4-7H2,1-3H3,(H2,20,24)(H,21,23)(H,22,25)/t11?,12-/m0/s1 |
| InChIKey | BKZMJAQYMZXNRI-KIYNQFGBSA-N |
| XLogP | 3.22 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|