C15H17ClFN3O3 — CID 88537956
(3S)-3-[(5-carbamoyl-6-chloro-3-fluoro-2-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 88537956) has the molecular formula C15H17ClFN3O3 and a molecular weight of 341.77 g/mol. Its IUPAC name is (3S)-3-[(5-carbamoyl-6-chloro-3-fluoro-2-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | (3S)-3-[(5-carbamoyl-6-chloro-3-fluoro-2-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 88537956 |
| Molecular Formula | C15H17ClFN3O3 |
| Molecular Weight | 341.77 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (3S)-3-[(5-carbamoyl-6-chloro-3-fluoro-2-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | NC(=O)c1cc(F)c(N[C@H]2C3CCC(CC3)C2C(=O)O)nc1Cl |
| InChI | InChI=1S/C15H17ClFN3O3/c16-12-8(13(18)21)5-9(17)14(20-12)19-11-7-3-1-6(2-4-7)10(11)15(22)23/h5-7,10-11H,1-4H2,(H2,18,21)(H,19,20)(H,22,23)/t6?,7?,10?,11-/m0/s1 |
| InChIKey | SFKLSRTYEHHSEJ-HBYHYRPRSA-N |
| XLogP | 2.27 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.77 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|