C13H13IO3 — CID 163456935
(1'R,2'S,7'S,8'S)-4'-iodospiro[1,3-dioxolane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one (PubChem CID 163456935) has the molecular formula C13H13IO3 and a molecular weight of 344.15 g/mol. Its IUPAC name is (1'R,2'S,7'S,8'S)-4'-iodospiro[1,3-dioxolane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one.
| Compound Name | (1'R,2'S,7'S,8'S)-4'-iodospiro[1,3-dioxolane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one |
|---|---|
| PubChem CID | 163456935 |
| Molecular Formula | C13H13IO3 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | (1'R,2'S,7'S,8'S)-4'-iodospiro[1,3-dioxolane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one |
| SMILES | O=C1C(I)=CC2(OCCO2)[C@@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C13H13IO3/c14-9-6-13(16-3-4-17-13)11-8-2-1-7(5-8)10(11)12(9)15/h1-2,6-8,10-11H,3-5H2/t7-,8+,10-,11-/m0/s1 |
| InChIKey | BLGMCYMBEVKXNG-OEIWMXHLSA-N |
| XLogP | 2.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|