C14H16O2 — CID 101188681
(2S,2'R,7'S)-spiro[oxolane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one (PubChem CID 101188681) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (2S,2'R,7'S)-spiro[oxolane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one.
| Compound Name | (2S,2'R,7'S)-spiro[oxolane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one |
|---|---|
| PubChem CID | 101188681 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (2S,2'R,7'S)-spiro[oxolane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one |
| SMILES | O=C1C=C[C@@]2(CCCO2)[C@H]2C3C=CC(C3)[C@@H]12 |
| InChI | InChI=1S/C14H16O2/c15-11-4-6-14(5-1-7-16-14)13-10-3-2-9(8-10)12(11)13/h2-4,6,9-10,12-13H,1,5,7-8H2/t9?,10?,12-,13-,14-/m0/s1 |
| InChIKey | BMPUWFFAVJHYFR-GJSOLXOQSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|