C25H24F2N2O4 — CID 163457102
methyl 5-[(2,5-difluorophenyl)methyl]-7-(2-methoxy-1,2,3,4-tetrahydropyridin-3-yl)-2,3-dihydrofuro[2,3-f]indole-6-carboxylate (PubChem CID 163457102) has the molecular formula C25H24F2N2O4 and a molecular weight of 454.47 g/mol. Its IUPAC name is methyl 5-[(2,5-difluorophenyl)methyl]-7-(2-methoxy-1,2,3,4-tetrahydropyridin-3-yl)-2,3-dihydrofuro[2,3-f]indole-6-carboxylate.
| Compound Name | methyl 5-[(2,5-difluorophenyl)methyl]-7-(2-methoxy-1,2,3,4-tetrahydropyridin-3-yl)-2,3-dihydrofuro[2,3-f]indole-6-carboxylate |
|---|---|
| PubChem CID | 163457102 |
| Molecular Formula | C25H24F2N2O4 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | methyl 5-[(2,5-difluorophenyl)methyl]-7-(2-methoxy-1,2,3,4-tetrahydropyridin-3-yl)-2,3-dihydrofuro[2,3-f]indole-6-carboxylate |
| SMILES | COC(=O)c1c(C2CC=CNC2OC)c2cc3c(cc2n1Cc1cc(F)ccc1F)CCO3 |
| InChI | InChI=1S/C25H24F2N2O4/c1-31-24-17(4-3-8-28-24)22-18-12-21-14(7-9-33-21)11-20(18)29(23(22)25(30)32-2)13-15-10-16(26)5-6-19(15)27/h3,5-6,8,10-12,17,24,28H,4,7,9,13H2,1-2H3 |
| InChIKey | BLJWICSVTBBEOP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|