C22H32O2 — CID 163459031
[(3S,8S,9S,10R,14S)-17-ethyl-10-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 163459031) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is [(3S,8S,9S,10R,14S)-17-ethyl-10-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,14S)-17-ethyl-10-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 163459031 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | [(3S,8S,9S,10R,14S)-17-ethyl-10-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCC1=C2CC[C@H]3[C@@H](CC=C4C[C@@H](OC(C)=O)CC[C@@]43C)[C@@H]2CC1 |
| InChI | InChI=1S/C22H32O2/c1-4-15-5-7-19-18(15)9-10-21-20(19)8-6-16-13-17(24-14(2)23)11-12-22(16,21)3/h6,17,19-21H,4-5,7-13H2,1-3H3/t17-,19+,20-,21-,22-/m0/s1 |
| InChIKey | BMZFCQLAXYGTGS-KVEDYDLGSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|