C39H46IrO2-2 — CID 163461355
2-(3,5-dimethylbenzene-6-id-1-yl)-4-(2-methylpropyl)-6-phenyl-1H-naphthalen-1-ide;5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium (PubChem CID 163461355) has the molecular formula C39H46IrO2-2 and a molecular weight of 739.01 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)-4-(2-methylpropyl)-6-phenyl-1H-naphthalen-1-ide;5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium.
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-4-(2-methylpropyl)-6-phenyl-1H-naphthalen-1-ide;5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 163461355 |
| Molecular Formula | C39H46IrO2-2 |
| Molecular Weight | 739.01 g/mol |
| Exact Mass | 739.31 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-4-(2-methylpropyl)-6-phenyl-1H-naphthalen-1-ide;5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
| SMILES | CC(C)(C)C(=O)C=C(O)C(C)(C)C.Cc1[c-]c(-c2[c-]c3ccc(-c4ccccc4)cc3c(CC(C)C)c2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C28H26.C11H20O2.Ir/c1-19(2)12-27-17-26(25-14-20(3)13-21(4)15-25)16-24-11-10-23(18-28(24)27)22-8-6-5-7-9-22;1-10(2,3)8(12)7-9(13)11(4,5)6;/h5-11,13-14,17-19H,12H2,1-4H3;7,12H,1-6H3;/q-2;; |
| InChIKey | KBYOFDWNURUUEB-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.01 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|