C9H8F3NO5 — CID 163463311
methyl 3-nitro-4-(trifluoromethoxy)cyclohexa-1,3-diene-1-carboxylate (PubChem CID 163463311) has the molecular formula C9H8F3NO5 and a molecular weight of 267.16 g/mol. Its IUPAC name is methyl 3-nitro-4-(trifluoromethoxy)cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | methyl 3-nitro-4-(trifluoromethoxy)cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 163463311 |
| Molecular Formula | C9H8F3NO5 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | methyl 3-nitro-4-(trifluoromethoxy)cyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC([N+](=O)[O-])=C(OC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H8F3NO5/c1-17-8(14)5-2-3-7(18-9(10,11)12)6(4-5)13(15)16/h4H,2-3H2,1H3 |
| InChIKey | BQLVZBJKMUVHGN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|