About methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate
methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate (PubChem CID 170168536) has the molecular formula C12H10F3NO3
and a molecular weight of 273.21 g/mol. Its IUPAC name is methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate.
Analyze methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate?
The IUPAC name of methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate (CID 170168536) is methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate.
What is the SMILES notation for methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate?
The canonical SMILES for methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate is COC(=O)C1=Cc2ccc(OC(F)(F)F)cc2NC1.
What is the InChIKey of methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate?
The InChIKey is VZNASUWQABVGEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3NO3/c1-18-11(17)8-4-7-2-3-9(19-12(13,14)15)5-10(7)16-6-8/h2-5,16H,6H2,1H3.
What are the key properties of methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate?
methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate has a molecular weight of 273.21 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-(trifluoromethoxy)-1,2-dihydroquinoline-3-carboxylate is sourced from PubChem (CID 170168536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).