About 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine
10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine (PubChem CID 163464217) has the molecular formula C34H24N3+
and a molecular weight of 474.59 g/mol. Its IUPAC name is 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine.
Molecular Properties
| Compound Name | 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine |
| PubChem CID | 163464217 |
| Molecular Formula | C34H24N3+ |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine |
| SMILES | C1=NC2c3ccccc3-c3cc(-c4cccc(-c5ccc6c(c5)-c5ccccc5[NH2+]6)c4)ccc3C2N=C1 |
| InChI | InChI=1S/C34H23N3/c1-2-10-27-25(8-1)29-19-23(12-14-28(29)34-33(27)35-16-17-36-34)21-6-5-7-22(18-21)24-13-15-32-30(20-24)26-9-3-4-11-31(26)37-32/h1-20,33-34,37H/p+1 |
| InChIKey | BRDRXHLJIVGFSI-UHFFFAOYSA-O |
| XLogP | 7.45 |
| TPSA | 41.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine?
The IUPAC name of 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine (CID 163464217) is 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine.
What is the SMILES notation for 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine?
The canonical SMILES for 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine is C1=NC2c3ccccc3-c3cc(-c4cccc(-c5ccc6c(c5)-c5ccccc5[NH2+]6)c4)ccc3C2N=C1.
What is the InChIKey of 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine?
The InChIKey is BRDRXHLJIVGFSI-UHFFFAOYSA-O. The full InChI is InChI=1S/C34H23N3/c1-2-10-27-25(8-1)29-19-23(12-14-28(29)34-33(27)35-16-17-36-34)21-6-5-7-22(18-21)24-13-15-32-30(20-24)26-9-3-4-11-31(26)37-32/h1-20,33-34,37H/p+1.
What are the key properties of 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine?
10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine has a molecular weight of 474.59 g/mol, XLogP of 7.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[3-(9H-carbazol-9-ium-3-yl)phenyl]-4a,12b-dihydrophenanthro[9,10-b]pyrazine is sourced from PubChem (CID 163464217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).