C14H25N3O4 — CID 163464416
N-[4-[acetyl(dimethylamino)amino]-4-oxobutanoyl]-N,2,2-trimethylpropanamide (PubChem CID 163464416) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-[4-[acetyl(dimethylamino)amino]-4-oxobutanoyl]-N,2,2-trimethylpropanamide.
| Compound Name | N-[4-[acetyl(dimethylamino)amino]-4-oxobutanoyl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 163464416 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | N-[4-[acetyl(dimethylamino)amino]-4-oxobutanoyl]-N,2,2-trimethylpropanamide |
| SMILES | CC(=O)N(C(=O)CCC(=O)N(C)C(=O)C(C)(C)C)N(C)C |
| InChI | InChI=1S/C14H25N3O4/c1-10(18)17(15(5)6)12(20)9-8-11(19)16(7)13(21)14(2,3)4/h8-9H2,1-7H3 |
| InChIKey | BRIATPSGIAVTEO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|