C11H19FO2S — CID 163464617
ethyl (7S)-6-ethyl-7-fluorothiepane-3-carboxylate (PubChem CID 163464617) has the molecular formula C11H19FO2S and a molecular weight of 234.34 g/mol. Its IUPAC name is ethyl (7S)-6-ethyl-7-fluorothiepane-3-carboxylate.
| Compound Name | ethyl (7S)-6-ethyl-7-fluorothiepane-3-carboxylate |
|---|---|
| PubChem CID | 163464617 |
| Molecular Formula | C11H19FO2S |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | ethyl (7S)-6-ethyl-7-fluorothiepane-3-carboxylate |
| SMILES | CCOC(=O)C1CCC(CC)[C@@H](F)SC1 |
| InChI | InChI=1S/C11H19FO2S/c1-3-8-5-6-9(7-15-10(8)12)11(13)14-4-2/h8-10H,3-7H2,1-2H3/t8?,9?,10-/m0/s1 |
| InChIKey | BRMABWJUAYIHBQ-RTBKNWGFSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |