C20H14N6O8S2 — CID 163465226
3-[[7-[(4-carboxyphenyl)sulfamoyl]-2-hydroxy-3-hydroxysulfanylnaphthalen-1-yl]diazenyl]-1H-1,2,4-triazole-5-carboxylic acid (PubChem CID 163465226) has the molecular formula C20H14N6O8S2 and a molecular weight of 530.50 g/mol. Its IUPAC name is 3-[[7-[(4-carboxyphenyl)sulfamoyl]-2-hydroxy-3-hydroxysulfanylnaphthalen-1-yl]diazenyl]-1H-1,2,4-triazole-5-carboxylic acid.
| Compound Name | 3-[[7-[(4-carboxyphenyl)sulfamoyl]-2-hydroxy-3-hydroxysulfanylnaphthalen-1-yl]diazenyl]-1H-1,2,4-triazole-5-carboxylic acid |
|---|---|
| PubChem CID | 163465226 |
| Molecular Formula | C20H14N6O8S2 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | 3-[[7-[(4-carboxyphenyl)sulfamoyl]-2-hydroxy-3-hydroxysulfanylnaphthalen-1-yl]diazenyl]-1H-1,2,4-triazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2ccc3cc(SO)c(O)c(/N=N/c4n[nH]c(C(=O)O)n4)c3c2)cc1 |
| InChI | InChI=1S/C20H14N6O8S2/c27-16-14(35-32)7-10-3-6-12(36(33,34)26-11-4-1-9(2-5-11)18(28)29)8-13(10)15(16)22-24-20-21-17(19(30)31)23-25-20/h1-8,26-27,32H,(H,28,29)(H,30,31)(H,21,23,25)/b24-22+ |
| InChIKey | BSABSTSFKBSKTE-ZNTNEXAZSA-N |
| XLogP | 3.84 |
| TPSA | 227.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|