C19H24N4O3 — CID 163465659
benzyl (2S,4S)-2-(5-tert-butyl-1,3-oxazol-2-yl)-4-diazenylpyrrolidine-1-carboxylate (PubChem CID 163465659) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is benzyl (2S,4S)-2-(5-tert-butyl-1,3-oxazol-2-yl)-4-diazenylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,4S)-2-(5-tert-butyl-1,3-oxazol-2-yl)-4-diazenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163465659 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | benzyl (2S,4S)-2-(5-tert-butyl-1,3-oxazol-2-yl)-4-diazenylpyrrolidine-1-carboxylate |
| SMILES | [H]/N=N/[C@H]1C[C@@H](c2ncc(C(C)(C)C)o2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C19H24N4O3/c1-19(2,3)16-10-21-17(26-16)15-9-14(22-20)11-23(15)18(24)25-12-13-7-5-4-6-8-13/h4-8,10,14-15,20H,9,11-12H2,1-3H3/b22-20+/t14-,15-/m0/s1 |
| InChIKey | BSJIWKPBNYGMQB-RWKIHEHNSA-N |
| XLogP | 4.46 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|