C16H18N2O4 — CID 71241700
benzyl (2S)-4-methoxy-2-(1,3-oxazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 71241700) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is benzyl (2S)-4-methoxy-2-(1,3-oxazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-4-methoxy-2-(1,3-oxazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71241700 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | benzyl (2S)-4-methoxy-2-(1,3-oxazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | COC1C[C@@H](c2ncco2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H18N2O4/c1-20-13-9-14(15-17-7-8-21-15)18(10-13)16(19)22-11-12-5-3-2-4-6-12/h2-8,13-14H,9-11H2,1H3/t13?,14-/m0/s1 |
| InChIKey | MBXPHZYZNUIIRJ-KZUDCZAMSA-N |
| XLogP | 2.77 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |