C48H29IO5 — CID 163467017
3-iodo-6-[10-[4-(4-phenyldibenzofuran-2-yl)naphthalen-2-yl]anthracen-9-yl]benzene-1,2,4,5-tetrol (PubChem CID 163467017) has the molecular formula C48H29IO5 and a molecular weight of 812.66 g/mol. Its IUPAC name is 3-iodo-6-[10-[4-(4-phenyldibenzofuran-2-yl)naphthalen-2-yl]anthracen-9-yl]benzene-1,2,4,5-tetrol.
| Compound Name | 3-iodo-6-[10-[4-(4-phenyldibenzofuran-2-yl)naphthalen-2-yl]anthracen-9-yl]benzene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 163467017 |
| Molecular Formula | C48H29IO5 |
| Molecular Weight | 812.66 g/mol |
| Exact Mass | 812.11 |
| IUPAC Name | 3-iodo-6-[10-[4-(4-phenyldibenzofuran-2-yl)naphthalen-2-yl]anthracen-9-yl]benzene-1,2,4,5-tetrol |
| SMILES | Oc1c(O)c(-c2c3ccccc3c(-c3cc(-c4cc(-c5ccccc5)c5oc6ccccc6c5c4)c4ccccc4c3)c3ccccc23)c(O)c(O)c1I |
| InChI | InChI=1S/C48H29IO5/c49-43-46(52)44(50)42(45(51)47(43)53)41-34-19-8-6-17-32(34)40(33-18-7-9-20-35(33)41)29-22-27-14-4-5-15-30(27)36(25-29)28-23-37(26-12-2-1-3-13-26)48-38(24-28)31-16-10-11-21-39(31)54-48/h1-25,50-53H |
| InChIKey | BTLXGRQFYBOJGT-UHFFFAOYSA-N |
| XLogP | 13.14 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.66 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|