C19H34O5 — CID 163468162
9-hydroxy-15-methoxy-4-propanoylpentadecane-2,12-dione (PubChem CID 163468162) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is 9-hydroxy-15-methoxy-4-propanoylpentadecane-2,12-dione.
| Compound Name | 9-hydroxy-15-methoxy-4-propanoylpentadecane-2,12-dione |
|---|---|
| PubChem CID | 163468162 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 9-hydroxy-15-methoxy-4-propanoylpentadecane-2,12-dione |
| SMILES | CCC(=O)C(CCCCC(O)CCC(=O)CCCOC)CC(C)=O |
| InChI | InChI=1S/C19H34O5/c1-4-19(23)16(14-15(2)20)8-5-6-9-17(21)11-12-18(22)10-7-13-24-3/h16-17,21H,4-14H2,1-3H3 |
| InChIKey | ARXIUZPUFJNEPH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|