C10H20O3 — CID 114854364
1,5-dimethoxy-6-methylheptan-4-one (PubChem CID 114854364) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1,5-dimethoxy-6-methylheptan-4-one.
| Compound Name | 1,5-dimethoxy-6-methylheptan-4-one |
|---|---|
| PubChem CID | 114854364 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 1,5-dimethoxy-6-methylheptan-4-one |
| SMILES | COCCCC(=O)C(OC)C(C)C |
| InChI | InChI=1S/C10H20O3/c1-8(2)10(13-4)9(11)6-5-7-12-3/h8,10H,5-7H2,1-4H3 |
| InChIKey | NCKMUDRKNAXPCR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|