C12H23NO3 — CID 163468988
(2S,4R)-2,3-bis(hydroxymethyl)-1-[(E)-pent-2-enyl]piperidin-4-ol (PubChem CID 163468988) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is (2S,4R)-2,3-bis(hydroxymethyl)-1-[(E)-pent-2-enyl]piperidin-4-ol.
| Compound Name | (2S,4R)-2,3-bis(hydroxymethyl)-1-[(E)-pent-2-enyl]piperidin-4-ol |
|---|---|
| PubChem CID | 163468988 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | (2S,4R)-2,3-bis(hydroxymethyl)-1-[(E)-pent-2-enyl]piperidin-4-ol |
| SMILES | CC/C=C/CN1CC[C@@H](O)C(CO)[C@H]1CO |
| InChI | InChI=1S/C12H23NO3/c1-2-3-4-6-13-7-5-12(16)10(8-14)11(13)9-15/h3-4,10-12,14-16H,2,5-9H2,1H3/b4-3+/t10?,11-,12-/m1/s1 |
| InChIKey | BVAJNSGHQLCKJQ-LOGFCMQFSA-N |
| XLogP | -0.01 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|