About 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene
6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene (PubChem CID 163470973) has the molecular formula C20H35Cl
and a molecular weight of 310.95 g/mol. Its IUPAC name is 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene.
Molecular Properties
| Compound Name | 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene |
| PubChem CID | 163470973 |
| Molecular Formula | C20H35Cl |
| Molecular Weight | 310.95 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene |
| SMILES | CC(C)(C)C1CCCC=C1Cl.CC1=CCCC1C(C)(C)C |
| InChI | InChI=1S/C10H17Cl.C10H18/c1-10(2,3)8-6-4-5-7-9(8)11;1-8-6-5-7-9(8)10(2,3)4/h7-8H,4-6H2,1-3H3;6,9H,5,7H2,1-4H3 |
| InChIKey | BWMXVFNYOBPEIY-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.95 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene?
The IUPAC name of 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene (CID 163470973) is 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene.
What is the SMILES notation for 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene?
The canonical SMILES for 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene is CC(C)(C)C1CCCC=C1Cl.CC1=CCCC1C(C)(C)C.
What is the InChIKey of 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene?
The InChIKey is BWMXVFNYOBPEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17Cl.C10H18/c1-10(2,3)8-6-4-5-7-9(8)11;1-8-6-5-7-9(8)10(2,3)4/h7-8H,4-6H2,1-3H3;6,9H,5,7H2,1-4H3.
What are the key properties of 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene?
6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene has a molecular weight of 310.95 g/mol, XLogP of 7.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-1-chlorocyclohexene;5-tert-butyl-1-methylcyclopentene is sourced from PubChem (CID 163470973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).