C17H15N3O5 — CID 163471099
nitroso 4-acetyl-3-oxo-7-pyridin-4-yl-5,6,7,8-tetrahydroisoquinoline-2-carboxylate (PubChem CID 163471099) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is nitroso 4-acetyl-3-oxo-7-pyridin-4-yl-5,6,7,8-tetrahydroisoquinoline-2-carboxylate.
| Compound Name | nitroso 4-acetyl-3-oxo-7-pyridin-4-yl-5,6,7,8-tetrahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 163471099 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | nitroso 4-acetyl-3-oxo-7-pyridin-4-yl-5,6,7,8-tetrahydroisoquinoline-2-carboxylate |
| SMILES | CC(=O)c1c2c(cn(C(=O)ON=O)c1=O)CC(c1ccncc1)CC2 |
| InChI | InChI=1S/C17H15N3O5/c1-10(21)15-14-3-2-12(11-4-6-18-7-5-11)8-13(14)9-20(16(15)22)17(23)25-19-24/h4-7,9,12H,2-3,8H2,1H3 |
| InChIKey | BWPHPUBISKIXKN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 107.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|