C10H15F2N — CID 163471796
2-(1,2-difluoroprop-2-enyl)-3-methylhexanenitrile (PubChem CID 163471796) has the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. Its IUPAC name is 2-(1,2-difluoroprop-2-enyl)-3-methylhexanenitrile.
| Compound Name | 2-(1,2-difluoroprop-2-enyl)-3-methylhexanenitrile |
|---|---|
| PubChem CID | 163471796 |
| Molecular Formula | C10H15F2N |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 2-(1,2-difluoroprop-2-enyl)-3-methylhexanenitrile |
| SMILES | C=C(F)C(F)C(C#N)C(C)CCC |
| InChI | InChI=1S/C10H15F2N/c1-4-5-7(2)9(6-13)10(12)8(3)11/h7,9-10H,3-5H2,1-2H3 |
| InChIKey | BXCMOCDCFQYTHD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |