C9H11IN4O2 — CID 163477108
4-(iodoiminomethyl)-2,5-dimethyl-6,7-dihydropyridazino[3,4-b][1,4]oxazin-3-one (PubChem CID 163477108) has the molecular formula C9H11IN4O2 and a molecular weight of 334.12 g/mol. Its IUPAC name is 4-(iodoiminomethyl)-2,5-dimethyl-6,7-dihydropyridazino[3,4-b][1,4]oxazin-3-one.
| Compound Name | 4-(iodoiminomethyl)-2,5-dimethyl-6,7-dihydropyridazino[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 163477108 |
| Molecular Formula | C9H11IN4O2 |
| Molecular Weight | 334.12 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 4-(iodoiminomethyl)-2,5-dimethyl-6,7-dihydropyridazino[3,4-b][1,4]oxazin-3-one |
| SMILES | CN1CCOc2nn(C)c(=O)c(C=NI)c21 |
| InChI | InChI=1S/C9H11IN4O2/c1-13-3-4-16-8-7(13)6(5-11-10)9(15)14(2)12-8/h5H,3-4H2,1-2H3 |
| InChIKey | CBKGVDBNBKRCGW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.12 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|