C15H27NO4 — CID 163479316
ethyl 3-[(2R)-3-methylbutan-2-yl]oxy-1-(1-nitrosoethyl)cyclopentane-1-carboxylate (PubChem CID 163479316) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is ethyl 3-[(2R)-3-methylbutan-2-yl]oxy-1-(1-nitrosoethyl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 3-[(2R)-3-methylbutan-2-yl]oxy-1-(1-nitrosoethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 163479316 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | ethyl 3-[(2R)-3-methylbutan-2-yl]oxy-1-(1-nitrosoethyl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(C)N=O)CCC(O[C@H](C)C(C)C)C1 |
| InChI | InChI=1S/C15H27NO4/c1-6-19-14(17)15(12(5)16-18)8-7-13(9-15)20-11(4)10(2)3/h10-13H,6-9H2,1-5H3/t11-,12?,13?,15?/m1/s1 |
| InChIKey | CDDOYXBFUNHKNT-PEGDAGBESA-N |
| XLogP | 3.30 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |