C39H71N3O12 — CID 163480364
N-[2-[2-aminoethyl(pentanoyl)amino]ethyl]-4-oxo-7-[3-(3-oxobutoxy)propoxy]-6,6-bis[3-(3-oxobutoxy)propoxymethyl]heptanamide (PubChem CID 163480364) has the molecular formula C39H71N3O12 and a molecular weight of 774.01 g/mol. Its IUPAC name is N-[2-[2-aminoethyl(pentanoyl)amino]ethyl]-4-oxo-7-[3-(3-oxobutoxy)propoxy]-6,6-bis[3-(3-oxobutoxy)propoxymethyl]heptanamide.
| Compound Name | N-[2-[2-aminoethyl(pentanoyl)amino]ethyl]-4-oxo-7-[3-(3-oxobutoxy)propoxy]-6,6-bis[3-(3-oxobutoxy)propoxymethyl]heptanamide |
|---|---|
| PubChem CID | 163480364 |
| Molecular Formula | C39H71N3O12 |
| Molecular Weight | 774.01 g/mol |
| Exact Mass | 773.50 |
| IUPAC Name | N-[2-[2-aminoethyl(pentanoyl)amino]ethyl]-4-oxo-7-[3-(3-oxobutoxy)propoxy]-6,6-bis[3-(3-oxobutoxy)propoxymethyl]heptanamide |
| SMILES | CCCCC(=O)N(CCN)CCNC(=O)CCC(=O)CC(COCCCOCCC(C)=O)(COCCCOCCC(C)=O)COCCCOCCC(C)=O |
| InChI | InChI=1S/C39H71N3O12/c1-5-6-10-38(48)42(18-16-40)19-17-41-37(47)12-11-36(46)29-39(30-52-23-7-20-49-26-13-33(2)43,31-53-24-8-21-50-27-14-34(3)44)32-54-25-9-22-51-28-15-35(4)45/h5-32,40H2,1-4H3,(H,41,47) |
| InChIKey | ARHPFQDQBNQGDY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 199.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.01 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|