C28H55N3O3 — CID 90402751
N-[2-[octanoyl-[2-(octanoylamino)ethyl]amino]ethyl]octanamide (PubChem CID 90402751) has the molecular formula C28H55N3O3 and a molecular weight of 481.77 g/mol. Its IUPAC name is N-[2-[octanoyl-[2-(octanoylamino)ethyl]amino]ethyl]octanamide.
| Compound Name | N-[2-[octanoyl-[2-(octanoylamino)ethyl]amino]ethyl]octanamide |
|---|---|
| PubChem CID | 90402751 |
| Molecular Formula | C28H55N3O3 |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 481.42 |
| IUPAC Name | N-[2-[octanoyl-[2-(octanoylamino)ethyl]amino]ethyl]octanamide |
| SMILES | CCCCCCCC(=O)NCCN(CCNC(=O)CCCCCCC)C(=O)CCCCCCC |
| InChI | InChI=1S/C28H55N3O3/c1-4-7-10-13-16-19-26(32)29-22-24-31(28(34)21-18-15-12-9-6-3)25-23-30-27(33)20-17-14-11-8-5-2/h4-25H2,1-3H3,(H,29,32)(H,30,33) |
| InChIKey | CJEGVXNQHRLHNK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|