C62H119N5O3 — CID 90684442
(Z)-N-[2-[2-[[(Z)-octadec-9-enoyl]-[2-[2-[[(Z)-octadec-9-enoyl]amino]ethylamino]ethyl]amino]ethylamino]ethyl]octadec-9-enamide (PubChem CID 90684442) has the molecular formula C62H119N5O3 and a molecular weight of 982.67 g/mol. Its IUPAC name is (Z)-N-[2-[2-[[(Z)-octadec-9-enoyl]-[2-[2-[[(Z)-octadec-9-enoyl]amino]ethylamino]ethyl]amino]ethylamino]ethyl]octadec-9-enamide.
| Compound Name | (Z)-N-[2-[2-[[(Z)-octadec-9-enoyl]-[2-[2-[[(Z)-octadec-9-enoyl]amino]ethylamino]ethyl]amino]ethylamino]ethyl]octadec-9-enamide |
|---|---|
| PubChem CID | 90684442 |
| Molecular Formula | C62H119N5O3 |
| Molecular Weight | 982.67 g/mol |
| Exact Mass | 981.93 |
| IUPAC Name | (Z)-N-[2-[2-[[(Z)-octadec-9-enoyl]-[2-[2-[[(Z)-octadec-9-enoyl]amino]ethylamino]ethyl]amino]ethylamino]ethyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCNCCN(CCNCCNC(=O)CCCCCCC/C=C\CCCCCCCC)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C62H119N5O3/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-60(68)65-54-52-63-56-58-67(62(70)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)59-57-64-53-55-66-61(69)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25-30,63-64H,4-24,31-59H2,1-3H3,(H,65,68)(H,66,69)/b28-25-,29-26-,30-27- |
| InChIKey | JTEGDCYVBLBGHB-IUPFWZBJSA-N |
| XLogP | 16.34 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 57 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.67 |
| LogP ≤ 5 | 16.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|