C40H43N5O8 — CID 163480468
(2S)-2-[[(2R)-5-[[7-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4,7-dioxoheptanoyl]amino]-2-benzyl-4-oxopentanoyl]amino]-5-(carbamoylamino)pentanoic acid (PubChem CID 163480468) has the molecular formula C40H43N5O8 and a molecular weight of 721.81 g/mol. Its IUPAC name is (2S)-2-[[(2R)-5-[[7-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4,7-dioxoheptanoyl]amino]-2-benzyl-4-oxopentanoyl]amino]-5-(carbamoylamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2R)-5-[[7-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4,7-dioxoheptanoyl]amino]-2-benzyl-4-oxopentanoyl]amino]-5-(carbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 163480468 |
| Molecular Formula | C40H43N5O8 |
| Molecular Weight | 721.81 g/mol |
| Exact Mass | 721.31 |
| IUPAC Name | (2S)-2-[[(2R)-5-[[7-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4,7-dioxoheptanoyl]amino]-2-benzyl-4-oxopentanoyl]amino]-5-(carbamoylamino)pentanoic acid |
| SMILES | NC(=O)NCCC[C@H](NC(=O)[C@@H](CC(=O)CNC(=O)CCC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C40H43N5O8/c41-40(53)42-22-8-14-34(39(51)52)44-38(50)31(23-27-9-2-1-3-10-27)24-33(47)25-43-36(48)20-18-32(46)19-21-37(49)45-26-30-13-5-4-11-28(30)16-17-29-12-6-7-15-35(29)45/h1-7,9-13,15,31,34H,8,14,18-26H2,(H,43,48)(H,44,50)(H,51,52)(H3,41,42,53)/t31-,34+/m1/s1 |
| InChIKey | YNCBCVKOLBCPQL-FJQKOURKSA-N |
| XLogP | 3.01 |
| TPSA | 205.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.81 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|