C8H10NO2PS — CID 163481194
2-methylsulfanyl-1,4-dihydro-3,1,2λ5-benzoxazaphosphinine 2-oxide (PubChem CID 163481194) has the molecular formula C8H10NO2PS and a molecular weight of 215.21 g/mol. Its IUPAC name is 2-methylsulfanyl-1,4-dihydro-3,1,2λ5-benzoxazaphosphinine 2-oxide.
| Compound Name | 2-methylsulfanyl-1,4-dihydro-3,1,2λ5-benzoxazaphosphinine 2-oxide |
|---|---|
| PubChem CID | 163481194 |
| Molecular Formula | C8H10NO2PS |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 2-methylsulfanyl-1,4-dihydro-3,1,2λ5-benzoxazaphosphinine 2-oxide |
| SMILES | CSP1(=O)Nc2ccccc2CO1 |
| InChI | InChI=1S/C8H10NO2PS/c1-13-12(10)9-8-5-3-2-4-7(8)6-11-12/h2-5H,6H2,1H3,(H,9,10) |
| InChIKey | CERORLQMJUPIAK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|