C21H27N5 — CID 163481953
5-[[4-methyl-4-[[(2-phenylcyclopropylidene)amino]methyl]piperidin-1-yl]methyl]pyrimidin-2-amine (PubChem CID 163481953) has the molecular formula C21H27N5 and a molecular weight of 349.48 g/mol. Its IUPAC name is 5-[[4-methyl-4-[[(2-phenylcyclopropylidene)amino]methyl]piperidin-1-yl]methyl]pyrimidin-2-amine.
| Compound Name | 5-[[4-methyl-4-[[(2-phenylcyclopropylidene)amino]methyl]piperidin-1-yl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 163481953 |
| Molecular Formula | C21H27N5 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 5-[[4-methyl-4-[[(2-phenylcyclopropylidene)amino]methyl]piperidin-1-yl]methyl]pyrimidin-2-amine |
| SMILES | CC1(C/N=C2\CC2c2ccccc2)CCN(Cc2cnc(N)nc2)CC1 |
| InChI | InChI=1S/C21H27N5/c1-21(15-25-19-11-18(19)17-5-3-2-4-6-17)7-9-26(10-8-21)14-16-12-23-20(22)24-13-16/h2-6,12-13,18H,7-11,14-15H2,1H3,(H2,22,23,24)/b25-19+ |
| InChIKey | CFHVWQDHSZYBAJ-NCELDCMTSA-N |
| XLogP | 3.29 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|