C12H21N2O3+ — CID 163483775
[(Z)-2-carboxy-3-(cyclohexylmethoxy)-3-(methylamino)prop-2-enylidene]azanium (PubChem CID 163483775) has the molecular formula C12H21N2O3+ and a molecular weight of 241.31 g/mol. Its IUPAC name is [(Z)-2-carboxy-3-(cyclohexylmethoxy)-3-(methylamino)prop-2-enylidene]azanium.
| Compound Name | [(Z)-2-carboxy-3-(cyclohexylmethoxy)-3-(methylamino)prop-2-enylidene]azanium |
|---|---|
| PubChem CID | 163483775 |
| Molecular Formula | C12H21N2O3+ |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | [(Z)-2-carboxy-3-(cyclohexylmethoxy)-3-(methylamino)prop-2-enylidene]azanium |
| SMILES | CN/C(OCC1CCCCC1)=C(\C=[NH2+])C(=O)O |
| InChI | InChI=1S/C12H20N2O3/c1-14-11(10(7-13)12(15)16)17-8-9-5-3-2-4-6-9/h7,9,13-14H,2-6,8H2,1H3,(H,15,16)/p+1/b11-10-,13-7? |
| InChIKey | CGUFEQCYTPDOKA-QXVPBRALSA-O |
| XLogP | -0.07 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|