C13H18N2O2 — CID 163487954
4-[(4-aminocyclohexa-2,4-dien-1-yl)oxymethoxy]cyclohexa-1,3-dien-1-amine (PubChem CID 163487954) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-[(4-aminocyclohexa-2,4-dien-1-yl)oxymethoxy]cyclohexa-1,3-dien-1-amine.
| Compound Name | 4-[(4-aminocyclohexa-2,4-dien-1-yl)oxymethoxy]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163487954 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-[(4-aminocyclohexa-2,4-dien-1-yl)oxymethoxy]cyclohexa-1,3-dien-1-amine |
| SMILES | NC1=CCC(OCOC2=CC=C(N)CC2)C=C1 |
| InChI | InChI=1S/C13H18N2O2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-3,5,7,12H,4,6,8-9,14-15H2 |
| InChIKey | CKDWKLGLZDCSMF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|