C11H18 — CID 163490022
1-ethyl-4-methyltricyclo[3.1.1.12,4]octane (PubChem CID 163490022) has the molecular formula C11H18 and a molecular weight of 150.27 g/mol. Its IUPAC name is 1-ethyl-4-methyltricyclo[3.1.1.12,4]octane.
| Compound Name | 1-ethyl-4-methyltricyclo[3.1.1.12,4]octane |
|---|---|
| PubChem CID | 163490022 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 1-ethyl-4-methyltricyclo[3.1.1.12,4]octane |
| SMILES | CCC12CC(C1)C1(C)CC2C1 |
| InChI | InChI=1S/C11H18/c1-3-11-6-8(7-11)10(2)4-9(11)5-10/h8-9H,3-7H2,1-2H3 |
| InChIKey | CLUFISGZJSAMCI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |