C25H41NO — CID 163490391
(2E)-2-ethylidene-1-[(3S,5S)-4-[[(3E)-hepta-1,3-dien-4-yl]-propan-2-ylamino]-3,5-dimethylcyclohexen-1-yl]pentan-1-one (PubChem CID 163490391) has the molecular formula C25H41NO and a molecular weight of 371.61 g/mol. Its IUPAC name is (2E)-2-ethylidene-1-[(3S,5S)-4-[[(3E)-hepta-1,3-dien-4-yl]-propan-2-ylamino]-3,5-dimethylcyclohexen-1-yl]pentan-1-one.
| Compound Name | (2E)-2-ethylidene-1-[(3S,5S)-4-[[(3E)-hepta-1,3-dien-4-yl]-propan-2-ylamino]-3,5-dimethylcyclohexen-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 163490391 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | (2E)-2-ethylidene-1-[(3S,5S)-4-[[(3E)-hepta-1,3-dien-4-yl]-propan-2-ylamino]-3,5-dimethylcyclohexen-1-yl]pentan-1-one |
| SMILES | C=C/C=C(\CCC)N(C(C)C)C1[C@@H](C)C=C(C(=O)/C(=C/C)CCC)C[C@@H]1C |
| InChI | InChI=1S/C25H41NO/c1-9-13-21(12-4)25(27)22-16-19(7)24(20(8)17-22)26(18(5)6)23(14-10-2)15-11-3/h10,12,14,16,18-20,24H,2,9,11,13,15,17H2,1,3-8H3/b21-12+,23-14+/t19-,20-,24?/m0/s1 |
| InChIKey | CMCKAQOCTDSRTK-JXRMLZNWSA-N |
| XLogP | 6.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|