C31H49NO — CID 123532213
1-[4-(6,7-dimethylnona-6,8-dienyl)-3-[methyl(3-methylpenta-1,3-dien-2-yl)amino]cyclohexa-1,3-dien-1-yl]-2-methylhexan-1-one (PubChem CID 123532213) has the molecular formula C31H49NO and a molecular weight of 451.74 g/mol. Its IUPAC name is 1-[4-(6,7-dimethylnona-6,8-dienyl)-3-[methyl(3-methylpenta-1,3-dien-2-yl)amino]cyclohexa-1,3-dien-1-yl]-2-methylhexan-1-one.
| Compound Name | 1-[4-(6,7-dimethylnona-6,8-dienyl)-3-[methyl(3-methylpenta-1,3-dien-2-yl)amino]cyclohexa-1,3-dien-1-yl]-2-methylhexan-1-one |
|---|---|
| PubChem CID | 123532213 |
| Molecular Formula | C31H49NO |
| Molecular Weight | 451.74 g/mol |
| Exact Mass | 451.38 |
| IUPAC Name | 1-[4-(6,7-dimethylnona-6,8-dienyl)-3-[methyl(3-methylpenta-1,3-dien-2-yl)amino]cyclohexa-1,3-dien-1-yl]-2-methylhexan-1-one |
| SMILES | C=CC(C)=C(C)CCCCCC1=C(N(C)C(=C)C(C)=CC)C=C(C(=O)C(C)CCCC)CC1 |
| InChI | InChI=1S/C31H49NO/c1-10-13-17-26(7)31(33)29-21-20-28(19-16-14-15-18-25(6)23(4)11-2)30(22-29)32(9)27(8)24(5)12-3/h11-12,22,26H,2,8,10,13-21H2,1,3-7,9H3 |
| InChIKey | QZZWPSVDANGGRV-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.74 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|