C26H38INO — CID 142019991
2-butyl-1-cyclohexa-1,4-dien-1-yl-5-[(5-iodo-2-methylcyclohexa-1,5-dien-1-yl)-propylamino]hex-5-en-1-one (PubChem CID 142019991) has the molecular formula C26H38INO and a molecular weight of 507.50 g/mol. Its IUPAC name is 2-butyl-1-cyclohexa-1,4-dien-1-yl-5-[(5-iodo-2-methylcyclohexa-1,5-dien-1-yl)-propylamino]hex-5-en-1-one.
| Compound Name | 2-butyl-1-cyclohexa-1,4-dien-1-yl-5-[(5-iodo-2-methylcyclohexa-1,5-dien-1-yl)-propylamino]hex-5-en-1-one |
|---|---|
| PubChem CID | 142019991 |
| Molecular Formula | C26H38INO |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 2-butyl-1-cyclohexa-1,4-dien-1-yl-5-[(5-iodo-2-methylcyclohexa-1,5-dien-1-yl)-propylamino]hex-5-en-1-one |
| SMILES | C=C(CCC(CCCC)C(=O)C1=CCC=CC1)N(CCC)C1=C(C)CCC(I)=C1 |
| InChI | InChI=1S/C26H38INO/c1-5-7-11-23(26(29)22-12-9-8-10-13-22)16-15-21(4)28(18-6-2)25-19-24(27)17-14-20(25)3/h8-9,13,19,23H,4-7,10-12,14-18H2,1-3H3 |
| InChIKey | JCFHZDNMWIUSCN-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|