C20H28ClNO — CID 143986099
[4-[but-3-enyl(2-chloroethyl)amino]cyclohex-3-en-1-yl]-(4-methylcyclohexa-1,3-dien-1-yl)methanone (PubChem CID 143986099) has the molecular formula C20H28ClNO and a molecular weight of 333.90 g/mol. Its IUPAC name is [4-[but-3-enyl(2-chloroethyl)amino]cyclohex-3-en-1-yl]-(4-methylcyclohexa-1,3-dien-1-yl)methanone.
| Compound Name | [4-[but-3-enyl(2-chloroethyl)amino]cyclohex-3-en-1-yl]-(4-methylcyclohexa-1,3-dien-1-yl)methanone |
|---|---|
| PubChem CID | 143986099 |
| Molecular Formula | C20H28ClNO |
| Molecular Weight | 333.90 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [4-[but-3-enyl(2-chloroethyl)amino]cyclohex-3-en-1-yl]-(4-methylcyclohexa-1,3-dien-1-yl)methanone |
| SMILES | C=CCCN(CCCl)C1=CCC(C(=O)C2=CC=C(C)CC2)CC1 |
| InChI | InChI=1S/C20H28ClNO/c1-3-4-14-22(15-13-21)19-11-9-18(10-12-19)20(23)17-7-5-16(2)6-8-17/h3,5,7,11,18H,1,4,6,8-10,12-15H2,2H3 |
| InChIKey | JSVONTVAPVZXOO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.90 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|