C24H37NO — CID 139691003
1-(4-heptylcyclohexyl)-4-methyl-5-(2H-pyridin-1-yl)penta-2,4-dien-1-one (PubChem CID 139691003) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is 1-(4-heptylcyclohexyl)-4-methyl-5-(2H-pyridin-1-yl)penta-2,4-dien-1-one.
| Compound Name | 1-(4-heptylcyclohexyl)-4-methyl-5-(2H-pyridin-1-yl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 139691003 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | 1-(4-heptylcyclohexyl)-4-methyl-5-(2H-pyridin-1-yl)penta-2,4-dien-1-one |
| SMILES | CCCCCCCC1CCC(C(=O)C=CC(C)=CN2C=CC=CC2)CC1 |
| InChI | InChI=1S/C24H37NO/c1-3-4-5-6-8-11-22-13-15-23(16-14-22)24(26)17-12-21(2)20-25-18-9-7-10-19-25/h7,9-10,12,17-18,20,22-23H,3-6,8,11,13-16,19H2,1-2H3 |
| InChIKey | RZNJZBPVBAPZFS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|