C52H34N6 — CID 163490932
6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoline (PubChem CID 163490932) has the molecular formula C52H34N6 and a molecular weight of 742.89 g/mol. Its IUPAC name is 6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoline.
| Compound Name | 6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoline |
|---|---|
| PubChem CID | 163490932 |
| Molecular Formula | C52H34N6 |
| Molecular Weight | 742.89 g/mol |
| Exact Mass | 742.28 |
| IUPAC Name | 6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoline |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4ccc5ncc(-c6cccc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)c6)cc5c4)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C52H34N6/c1-5-15-35(16-6-1)47-33-48(55-49(54-47)36-17-7-2-8-18-36)42-25-13-23-39(29-42)41-27-28-46-44(31-41)32-45(34-53-46)40-24-14-26-43(30-40)52-57-50(37-19-9-3-10-20-37)56-51(58-52)38-21-11-4-12-22-38/h1-34H |
| InChIKey | CMNZJPWAEXEWOR-UHFFFAOYSA-N |
| XLogP | 12.55 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.89 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |