About iodo 4-but-3-enylbenzoate
iodo 4-but-3-enylbenzoate (PubChem CID 163491431) has the molecular formula C11H11IO2
and a molecular weight of 302.11 g/mol. Its IUPAC name is iodo 4-but-3-enylbenzoate.
Molecular Properties
| Compound Name | iodo 4-but-3-enylbenzoate |
| PubChem CID | 163491431 |
| Molecular Formula | C11H11IO2 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | iodo 4-but-3-enylbenzoate |
| SMILES | C=CCCc1ccc(C(=O)OI)cc1 |
| InChI | InChI=1S/C11H11IO2/c1-2-3-4-9-5-7-10(8-6-9)11(13)14-12/h2,5-8H,1,3-4H2 |
| InChIKey | CMYNMJLEPJQYCN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze iodo 4-but-3-enylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo 4-but-3-enylbenzoate?
The IUPAC name of iodo 4-but-3-enylbenzoate (CID 163491431) is iodo 4-but-3-enylbenzoate.
What is the SMILES notation for iodo 4-but-3-enylbenzoate?
The canonical SMILES for iodo 4-but-3-enylbenzoate is C=CCCc1ccc(C(=O)OI)cc1.
What is the InChIKey of iodo 4-but-3-enylbenzoate?
The InChIKey is CMYNMJLEPJQYCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11IO2/c1-2-3-4-9-5-7-10(8-6-9)11(13)14-12/h2,5-8H,1,3-4H2.
What are the key properties of iodo 4-but-3-enylbenzoate?
iodo 4-but-3-enylbenzoate has a molecular weight of 302.11 g/mol, XLogP of 3.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iodo 4-but-3-enylbenzoate is sourced from PubChem (CID 163491431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).