C33H49N7O8 — CID 163491657
4-[[2-[[2-[[2-[[2-[[2-formyl-3-[3-(3-methylpentan-3-yl)-2,5-dioxopyrrolidin-1-yl]propyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]butanamide (PubChem CID 163491657) has the molecular formula C33H49N7O8 and a molecular weight of 671.80 g/mol. Its IUPAC name is 4-[[2-[[2-[[2-[[2-[[2-formyl-3-[3-(3-methylpentan-3-yl)-2,5-dioxopyrrolidin-1-yl]propyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]butanamide.
| Compound Name | 4-[[2-[[2-[[2-[[2-[[2-formyl-3-[3-(3-methylpentan-3-yl)-2,5-dioxopyrrolidin-1-yl]propyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]butanamide |
|---|---|
| PubChem CID | 163491657 |
| Molecular Formula | C33H49N7O8 |
| Molecular Weight | 671.80 g/mol |
| Exact Mass | 671.36 |
| IUPAC Name | 4-[[2-[[2-[[2-[[2-[[2-formyl-3-[3-(3-methylpentan-3-yl)-2,5-dioxopyrrolidin-1-yl]propyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]butanamide |
| SMILES | CCC(C)(CC)C1CC(=O)N(CC(C=O)CNCC(=O)NCC(=O)NC(Cc2ccccc2)C(=O)NCC(=O)NCCCC(N)=O)C1=O |
| InChI | InChI=1S/C33H49N7O8/c1-4-33(3,5-2)24-15-30(46)40(32(24)48)20-23(21-41)16-35-17-27(43)37-19-29(45)39-25(14-22-10-7-6-8-11-22)31(47)38-18-28(44)36-13-9-12-26(34)42/h6-8,10-11,21,23-25,35H,4-5,9,12-20H2,1-3H3,(H2,34,42)(H,36,44)(H,37,43)(H,38,47)(H,39,45) |
| InChIKey | CNDXXFRTGFYITC-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 225.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.80 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|