C21H30N2O4 — CID 163494918
(9R,10S)-4-[amino(hydroxy)methyl]-17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,10,13-triol (PubChem CID 163494918) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is (9R,10S)-4-[amino(hydroxy)methyl]-17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,10,13-triol.
| Compound Name | (9R,10S)-4-[amino(hydroxy)methyl]-17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,10,13-triol |
|---|---|
| PubChem CID | 163494918 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (9R,10S)-4-[amino(hydroxy)methyl]-17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,10,13-triol |
| SMILES | NC(O)c1ccc2c(c1O)C13CCN(CC4CC4)[C@H](C2)[C@]1(O)CCC(O)C3 |
| InChI | InChI=1S/C21H30N2O4/c22-19(26)15-4-3-13-9-16-21(27)6-5-14(24)10-20(21,17(13)18(15)25)7-8-23(16)11-12-1-2-12/h3-4,12,14,16,19,24-27H,1-2,5-11,22H2/t14?,16-,19?,20?,21-/m1/s1 |
| InChIKey | CPWCHOYZWVEJNP-OFXGPHJYSA-N |
| XLogP | 0.90 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|