C21H29NO4 — CID 130291560
(1R,9R,10S,13S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,4,10,13-tetrol (PubChem CID 130291560) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (1R,9R,10S,13S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,4,10,13-tetrol.
| Compound Name | (1R,9R,10S,13S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,4,10,13-tetrol |
|---|---|
| PubChem CID | 130291560 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (1R,9R,10S,13S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,4,10,13-tetrol |
| SMILES | Oc1ccc2c(c1O)[C@]13CCN(CC4CCC4)[C@H](C2)[C@]1(O)CC[C@H](O)C3 |
| InChI | InChI=1S/C21H29NO4/c23-15-6-7-21(26)17-10-14-4-5-16(24)19(25)18(14)20(21,11-15)8-9-22(17)12-13-2-1-3-13/h4-5,13,15,17,23-26H,1-3,6-12H2/t15-,17+,20+,21+/m0/s1 |
| InChIKey | MHLXDNKHVRLZCT-AXNOTKAXSA-N |
| XLogP | 2.04 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|