C13H21NO — CID 163495377
4-but-3-enoxy-5-ethenylhepta-4,6-dien-1-amine (PubChem CID 163495377) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-but-3-enoxy-5-ethenylhepta-4,6-dien-1-amine.
| Compound Name | 4-but-3-enoxy-5-ethenylhepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 163495377 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 4-but-3-enoxy-5-ethenylhepta-4,6-dien-1-amine |
| SMILES | C=CCCOC(CCCN)=C(C=C)C=C |
| InChI | InChI=1S/C13H21NO/c1-4-7-11-15-13(9-8-10-14)12(5-2)6-3/h4-6H,1-3,7-11,14H2 |
| InChIKey | CQGCLZZFZXYFEV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|