C25H22FNO3 — CID 163495638
(6S)-6-[(E)-2-[2-cyclopropyl-4-(4-fluoro-2-hydroxyphenyl)quinolin-3-yl]ethenyl]oxan-2-one (PubChem CID 163495638) has the molecular formula C25H22FNO3 and a molecular weight of 403.45 g/mol. Its IUPAC name is (6S)-6-[(E)-2-[2-cyclopropyl-4-(4-fluoro-2-hydroxyphenyl)quinolin-3-yl]ethenyl]oxan-2-one.
| Compound Name | (6S)-6-[(E)-2-[2-cyclopropyl-4-(4-fluoro-2-hydroxyphenyl)quinolin-3-yl]ethenyl]oxan-2-one |
|---|---|
| PubChem CID | 163495638 |
| Molecular Formula | C25H22FNO3 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (6S)-6-[(E)-2-[2-cyclopropyl-4-(4-fluoro-2-hydroxyphenyl)quinolin-3-yl]ethenyl]oxan-2-one |
| SMILES | O=C1CCC[C@@H](/C=C/c2c(C3CC3)nc3ccccc3c2-c2ccc(F)cc2O)O1 |
| InChI | InChI=1S/C25H22FNO3/c26-16-10-12-19(22(28)14-16)24-18-5-1-2-6-21(18)27-25(15-8-9-15)20(24)13-11-17-4-3-7-23(29)30-17/h1-2,5-6,10-15,17,28H,3-4,7-9H2/b13-11+/t17-/m0/s1 |
| InChIKey | CQKSOHKOFJZYNH-HVJHFUJKSA-N |
| XLogP | 5.73 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |