C23H26ClN4O3+ — CID 163497391
[(3R)-1-[2-[(2S)-4-(3-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]acetyl]pyrrolidin-3-yl]oxidanium (PubChem CID 163497391) has the molecular formula C23H26ClN4O3+ and a molecular weight of 441.94 g/mol. Its IUPAC name is [(3R)-1-[2-[(2S)-4-(3-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]acetyl]pyrrolidin-3-yl]oxidanium.
| Compound Name | [(3R)-1-[2-[(2S)-4-(3-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]acetyl]pyrrolidin-3-yl]oxidanium |
|---|---|
| PubChem CID | 163497391 |
| Molecular Formula | C23H26ClN4O3+ |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | [(3R)-1-[2-[(2S)-4-(3-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]acetyl]pyrrolidin-3-yl]oxidanium |
| SMILES | O=C(C[C@H]1CN(C2=Nc3cc(Cl)ccc3Oc3ccccc32)CCN1)N1CC[C@@H]([OH2+])C1 |
| InChI | InChI=1S/C23H25ClN4O3/c24-15-5-6-21-19(11-15)26-23(18-3-1-2-4-20(18)31-21)28-10-8-25-16(13-28)12-22(30)27-9-7-17(29)14-27/h1-6,11,16-17,25,29H,7-10,12-14H2/p+1/t16-,17+/m0/s1 |
| InChIKey | CRWWFWDZGIELJS-DLBZAZTESA-O |
| XLogP | 2.51 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|