C23H27ClN4O3 — CID 66601915
2-[4-(3-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 66601915) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is 2-[4-(3-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-(3-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 66601915 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[4-(3-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CC1CN(C2=Nc3cc(Cl)ccc3Oc3ccccc32)CCN1 |
| InChI | InChI=1S/C23H27ClN4O3/c1-30-12-4-9-26-22(29)14-17-15-28(11-10-25-17)23-18-5-2-3-6-20(18)31-21-8-7-16(24)13-19(21)27-23/h2-3,5-8,13,17,25H,4,9-12,14-15H2,1H3,(H,26,29) |
| InChIKey | JSRONYJKZINIIO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|