C25H30ClN3O3 — CID 19004096
ethyl 6-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]hexanoate (PubChem CID 19004096) has the molecular formula C25H30ClN3O3 and a molecular weight of 455.99 g/mol. Its IUPAC name is ethyl 6-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]hexanoate.
| Compound Name | ethyl 6-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]hexanoate |
|---|---|
| PubChem CID | 19004096 |
| Molecular Formula | C25H30ClN3O3 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | ethyl 6-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCN1CCN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C25H30ClN3O3/c1-2-31-24(30)10-4-3-7-13-28-14-16-29(17-15-28)25-20-18-19(26)11-12-22(20)32-23-9-6-5-8-21(23)27-25/h5-6,8-9,11-12,18H,2-4,7,10,13-17H2,1H3 |
| InChIKey | OMOKMRLPUJILEE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|